About methyl 2-[(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)amino]butanoate
methyl 2-[(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)amino]butanoate (PubChem CID 115352554) has the molecular formula C14H18FNO2S
and a molecular weight of 283.37 g/mol. Its IUPAC name is methyl 2-[(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)amino]butanoate.
Molecular Properties
| Compound Name | methyl 2-[(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)amino]butanoate |
| PubChem CID | 115352554 |
| Molecular Formula | C14H18FNO2S |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | methyl 2-[(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)amino]butanoate |
| SMILES | CCC(NC1CCSc2ccc(F)cc21)C(=O)OC |
| InChI | InChI=1S/C14H18FNO2S/c1-3-11(14(17)18-2)16-12-6-7-19-13-5-4-9(15)8-10(12)13/h4-5,8,11-12,16H,3,6-7H2,1-2H3 |
| InChIKey | LICNOAJCWZOVKM-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-[(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)amino]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)amino]butanoate?
The IUPAC name of methyl 2-[(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)amino]butanoate (CID 115352554) is methyl 2-[(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)amino]butanoate.
What is the SMILES notation for methyl 2-[(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)amino]butanoate?
The canonical SMILES for methyl 2-[(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)amino]butanoate is CCC(NC1CCSc2ccc(F)cc21)C(=O)OC.
What is the InChIKey of methyl 2-[(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)amino]butanoate?
The InChIKey is LICNOAJCWZOVKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18FNO2S/c1-3-11(14(17)18-2)16-12-6-7-19-13-5-4-9(15)8-10(12)13/h4-5,8,11-12,16H,3,6-7H2,1-2H3.
What are the key properties of methyl 2-[(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)amino]butanoate?
methyl 2-[(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)amino]butanoate has a molecular weight of 283.37 g/mol, XLogP of 2.90, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)amino]butanoate is sourced from PubChem (CID 115352554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).