C11H16N4O3 — CID 115356492
6-[[2-(tert-butylamino)-2-oxoethyl]amino]pyridazine-3-carboxylic acid (PubChem CID 115356492) has the molecular formula C11H16N4O3 and a molecular weight of 252.27 g/mol. Its IUPAC name is 6-[[2-(tert-butylamino)-2-oxoethyl]amino]pyridazine-3-carboxylic acid.
| Compound Name | 6-[[2-(tert-butylamino)-2-oxoethyl]amino]pyridazine-3-carboxylic acid |
|---|---|
| PubChem CID | 115356492 |
| Molecular Formula | C11H16N4O3 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | 6-[[2-(tert-butylamino)-2-oxoethyl]amino]pyridazine-3-carboxylic acid |
| SMILES | CC(C)(C)NC(=O)CNc1ccc(C(=O)O)nn1 |
| InChI | InChI=1S/C11H16N4O3/c1-11(2,3)13-9(16)6-12-8-5-4-7(10(17)18)14-15-8/h4-5H,6H2,1-3H3,(H,12,15)(H,13,16)(H,17,18) |
| InChIKey | WQKCBIQSKPQJMW-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |