C13H17N5O — CID 78988508
N-tert-butyl-2-(pyrido[2,3-b]pyrazin-6-ylamino)acetamide (PubChem CID 78988508) has the molecular formula C13H17N5O and a molecular weight of 259.31 g/mol. Its IUPAC name is N-tert-butyl-2-(pyrido[2,3-b]pyrazin-6-ylamino)acetamide.
| Compound Name | N-tert-butyl-2-(pyrido[2,3-b]pyrazin-6-ylamino)acetamide |
|---|---|
| PubChem CID | 78988508 |
| Molecular Formula | C13H17N5O |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | N-tert-butyl-2-(pyrido[2,3-b]pyrazin-6-ylamino)acetamide |
| SMILES | CC(C)(C)NC(=O)CNc1ccc2nccnc2n1 |
| InChI | InChI=1S/C13H17N5O/c1-13(2,3)18-11(19)8-16-10-5-4-9-12(17-10)15-7-6-14-9/h4-7H,8H2,1-3H3,(H,18,19)(H,15,16,17) |
| InChIKey | APBHWYAGHZRPFE-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |