C7H9N3O3 — CID 62487295
6-(2-hydroxyethylamino)pyridazine-3-carboxylic acid (PubChem CID 62487295) has the molecular formula C7H9N3O3 and a molecular weight of 183.17 g/mol. Its IUPAC name is 6-(2-hydroxyethylamino)pyridazine-3-carboxylic acid.
| Compound Name | 6-(2-hydroxyethylamino)pyridazine-3-carboxylic acid |
|---|---|
| PubChem CID | 62487295 |
| Molecular Formula | C7H9N3O3 |
| Molecular Weight | 183.17 g/mol |
| Exact Mass | 183.06 |
| IUPAC Name | 6-(2-hydroxyethylamino)pyridazine-3-carboxylic acid |
| SMILES | O=C(O)c1ccc(NCCO)nn1 |
| InChI | InChI=1S/C7H9N3O3/c11-4-3-8-6-2-1-5(7(12)13)9-10-6/h1-2,11H,3-4H2,(H,8,10)(H,12,13) |
| InChIKey | ZJTIDLKIVMETPE-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.17 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |