C12H18N4O2 — CID 55135442
6-(3-pyrrolidin-1-ylpropylamino)pyridazine-3-carboxylic acid (PubChem CID 55135442) has the molecular formula C12H18N4O2 and a molecular weight of 250.30 g/mol. Its IUPAC name is 6-(3-pyrrolidin-1-ylpropylamino)pyridazine-3-carboxylic acid.
| Compound Name | 6-(3-pyrrolidin-1-ylpropylamino)pyridazine-3-carboxylic acid |
|---|---|
| PubChem CID | 55135442 |
| Molecular Formula | C12H18N4O2 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 6-(3-pyrrolidin-1-ylpropylamino)pyridazine-3-carboxylic acid |
| SMILES | O=C(O)c1ccc(NCCCN2CCCC2)nn1 |
| InChI | InChI=1S/C12H18N4O2/c17-12(18)10-4-5-11(15-14-10)13-6-3-9-16-7-1-2-8-16/h4-5H,1-3,6-9H2,(H,13,15)(H,17,18) |
| InChIKey | AURPVJXZLGSBSP-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|