C17H30O3 — CID 11536484
(1R,3R,4R,5S,6R,7S)-5-(methoxymethoxy)-2,2,4,5,7-pentamethyltricyclo[4.3.1.03,7]decan-3-ol (PubChem CID 11536484) has the molecular formula C17H30O3 and a molecular weight of 282.42 g/mol. Its IUPAC name is (1R,3R,4R,5S,6R,7S)-5-(methoxymethoxy)-2,2,4,5,7-pentamethyltricyclo[4.3.1.03,7]decan-3-ol.
| Compound Name | (1R,3R,4R,5S,6R,7S)-5-(methoxymethoxy)-2,2,4,5,7-pentamethyltricyclo[4.3.1.03,7]decan-3-ol |
|---|---|
| PubChem CID | 11536484 |
| Molecular Formula | C17H30O3 |
| Molecular Weight | 282.42 g/mol |
| Exact Mass | 282.22 |
| IUPAC Name | (1R,3R,4R,5S,6R,7S)-5-(methoxymethoxy)-2,2,4,5,7-pentamethyltricyclo[4.3.1.03,7]decan-3-ol |
| SMILES | COCO[C@@]1(C)[C@@H]2C[C@H]3CC[C@]2(C)[C@@](O)([C@H]1C)C3(C)C |
| InChI | InChI=1S/C17H30O3/c1-11-16(5,20-10-19-6)13-9-12-7-8-15(13,4)17(11,18)14(12,2)3/h11-13,18H,7-10H2,1-6H3/t11-,12+,13+,15-,16+,17+/m0/s1 |
| InChIKey | BIDQHQQAJPDFEK-UHFNRVLPSA-N |
| XLogP | 3.21 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.42 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|