C14H20FN3S — CID 115368512
4-[(1,2-dimethylpiperidin-4-yl)amino]-2-fluorobenzenecarbothioamide (PubChem CID 115368512) has the molecular formula C14H20FN3S and a molecular weight of 281.40 g/mol. Its IUPAC name is 4-[(1,2-dimethylpiperidin-4-yl)amino]-2-fluorobenzenecarbothioamide.
| Compound Name | 4-[(1,2-dimethylpiperidin-4-yl)amino]-2-fluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 115368512 |
| Molecular Formula | C14H20FN3S |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 4-[(1,2-dimethylpiperidin-4-yl)amino]-2-fluorobenzenecarbothioamide |
| SMILES | CC1CC(Nc2ccc(C(N)=S)c(F)c2)CCN1C |
| InChI | InChI=1S/C14H20FN3S/c1-9-7-11(5-6-18(9)2)17-10-3-4-12(14(16)19)13(15)8-10/h3-4,8-9,11,17H,5-7H2,1-2H3,(H2,16,19) |
| InChIKey | IIZNQJWKWZCZSJ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|