C15H21FN2S — CID 115368368
4-[(2,4-dimethylcyclohexyl)amino]-2-fluorobenzenecarbothioamide (PubChem CID 115368368) has the molecular formula C15H21FN2S and a molecular weight of 280.41 g/mol. Its IUPAC name is 4-[(2,4-dimethylcyclohexyl)amino]-2-fluorobenzenecarbothioamide.
| Compound Name | 4-[(2,4-dimethylcyclohexyl)amino]-2-fluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 115368368 |
| Molecular Formula | C15H21FN2S |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | 4-[(2,4-dimethylcyclohexyl)amino]-2-fluorobenzenecarbothioamide |
| SMILES | CC1CCC(Nc2ccc(C(N)=S)c(F)c2)C(C)C1 |
| InChI | InChI=1S/C15H21FN2S/c1-9-3-6-14(10(2)7-9)18-11-4-5-12(15(17)19)13(16)8-11/h4-5,8-10,14,18H,3,6-7H2,1-2H3,(H2,17,19) |
| InChIKey | UMLQORRQRLQQSA-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|