C11H10BrNO2S2 — CID 115380653
2-(3-bromothiophen-2-yl)-2-(thiophen-2-ylmethylamino)acetic acid (PubChem CID 115380653) has the molecular formula C11H10BrNO2S2 and a molecular weight of 332.24 g/mol. Its IUPAC name is 2-(3-bromothiophen-2-yl)-2-(thiophen-2-ylmethylamino)acetic acid.
| Compound Name | 2-(3-bromothiophen-2-yl)-2-(thiophen-2-ylmethylamino)acetic acid |
|---|---|
| PubChem CID | 115380653 |
| Molecular Formula | C11H10BrNO2S2 |
| Molecular Weight | 332.24 g/mol |
| Exact Mass | 330.93 |
| IUPAC Name | 2-(3-bromothiophen-2-yl)-2-(thiophen-2-ylmethylamino)acetic acid |
| SMILES | O=C(O)C(NCc1cccs1)c1sccc1Br |
| InChI | InChI=1S/C11H10BrNO2S2/c12-8-3-5-17-10(8)9(11(14)15)13-6-7-2-1-4-16-7/h1-5,9,13H,6H2,(H,14,15) |
| InChIKey | SVDQZJIJLUVNMU-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.24 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |