C13H11BrClNO2S — CID 66156659
2-(2-bromo-5-chlorophenyl)-2-(thiophen-2-ylmethylamino)acetic acid (PubChem CID 66156659) has the molecular formula C13H11BrClNO2S and a molecular weight of 360.66 g/mol. Its IUPAC name is 2-(2-bromo-5-chlorophenyl)-2-(thiophen-2-ylmethylamino)acetic acid.
| Compound Name | 2-(2-bromo-5-chlorophenyl)-2-(thiophen-2-ylmethylamino)acetic acid |
|---|---|
| PubChem CID | 66156659 |
| Molecular Formula | C13H11BrClNO2S |
| Molecular Weight | 360.66 g/mol |
| Exact Mass | 358.94 |
| IUPAC Name | 2-(2-bromo-5-chlorophenyl)-2-(thiophen-2-ylmethylamino)acetic acid |
| SMILES | O=C(O)C(NCc1cccs1)c1cc(Cl)ccc1Br |
| InChI | InChI=1S/C13H11BrClNO2S/c14-11-4-3-8(15)6-10(11)12(13(17)18)16-7-9-2-1-5-19-9/h1-6,12,16H,7H2,(H,17,18) |
| InChIKey | DXZMGIDFRZUCRZ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.66 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |