C12H13BrIN3S — CID 115381240
2-(3-bromothiophen-2-yl)-5-iodo-6-(2-methylpropyl)pyrimidin-4-amine (PubChem CID 115381240) has the molecular formula C12H13BrIN3S and a molecular weight of 438.13 g/mol. Its IUPAC name is 2-(3-bromothiophen-2-yl)-5-iodo-6-(2-methylpropyl)pyrimidin-4-amine.
| Compound Name | 2-(3-bromothiophen-2-yl)-5-iodo-6-(2-methylpropyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 115381240 |
| Molecular Formula | C12H13BrIN3S |
| Molecular Weight | 438.13 g/mol |
| Exact Mass | 436.91 |
| IUPAC Name | 2-(3-bromothiophen-2-yl)-5-iodo-6-(2-methylpropyl)pyrimidin-4-amine |
| SMILES | CC(C)Cc1nc(-c2sccc2Br)nc(N)c1I |
| InChI | InChI=1S/C12H13BrIN3S/c1-6(2)5-8-9(14)11(15)17-12(16-8)10-7(13)3-4-18-10/h3-4,6H,5H2,1-2H3,(H2,15,16,17) |
| InChIKey | PKBPLGJHSRJRND-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.13 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|