C13H12BrNO4S — CID 115381819
4-bromo-2-(1-ethyl-2,5-dioxopyrrolidin-3-yl)sulfanylbenzoic acid (PubChem CID 115381819) has the molecular formula C13H12BrNO4S and a molecular weight of 358.21 g/mol. Its IUPAC name is 4-bromo-2-(1-ethyl-2,5-dioxopyrrolidin-3-yl)sulfanylbenzoic acid.
| Compound Name | 4-bromo-2-(1-ethyl-2,5-dioxopyrrolidin-3-yl)sulfanylbenzoic acid |
|---|---|
| PubChem CID | 115381819 |
| Molecular Formula | C13H12BrNO4S |
| Molecular Weight | 358.21 g/mol |
| Exact Mass | 356.97 |
| IUPAC Name | 4-bromo-2-(1-ethyl-2,5-dioxopyrrolidin-3-yl)sulfanylbenzoic acid |
| SMILES | CCN1C(=O)CC(Sc2cc(Br)ccc2C(=O)O)C1=O |
| InChI | InChI=1S/C13H12BrNO4S/c1-2-15-11(16)6-10(12(15)17)20-9-5-7(14)3-4-8(9)13(18)19/h3-5,10H,2,6H2,1H3,(H,18,19) |
| InChIKey | KKHYIPSIQXESEI-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.21 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|