C13H13F2N3OS2 — CID 115385162
4,5-difluoro-2-[3-(3-methyl-1,4-dithian-2-yl)-1,2,4-oxadiazol-5-yl]aniline (PubChem CID 115385162) has the molecular formula C13H13F2N3OS2 and a molecular weight of 329.40 g/mol. Its IUPAC name is 4,5-difluoro-2-[3-(3-methyl-1,4-dithian-2-yl)-1,2,4-oxadiazol-5-yl]aniline.
| Compound Name | 4,5-difluoro-2-[3-(3-methyl-1,4-dithian-2-yl)-1,2,4-oxadiazol-5-yl]aniline |
|---|---|
| PubChem CID | 115385162 |
| Molecular Formula | C13H13F2N3OS2 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.05 |
| IUPAC Name | 4,5-difluoro-2-[3-(3-methyl-1,4-dithian-2-yl)-1,2,4-oxadiazol-5-yl]aniline |
| SMILES | CC1SCCSC1c1noc(-c2cc(F)c(F)cc2N)n1 |
| InChI | InChI=1S/C13H13F2N3OS2/c1-6-11(21-3-2-20-6)12-17-13(19-18-12)7-4-8(14)9(15)5-10(7)16/h4-6,11H,2-3,16H2,1H3 |
| InChIKey | SQQKDYKWBNLCBE-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|