C13H15ClOS2 — CID 115385760
2-(3-chlorophenyl)-1-(3-methyl-1,4-dithian-2-yl)ethanone (PubChem CID 115385760) has the molecular formula C13H15ClOS2 and a molecular weight of 286.85 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-1-(3-methyl-1,4-dithian-2-yl)ethanone.
| Compound Name | 2-(3-chlorophenyl)-1-(3-methyl-1,4-dithian-2-yl)ethanone |
|---|---|
| PubChem CID | 115385760 |
| Molecular Formula | C13H15ClOS2 |
| Molecular Weight | 286.85 g/mol |
| Exact Mass | 286.03 |
| IUPAC Name | 2-(3-chlorophenyl)-1-(3-methyl-1,4-dithian-2-yl)ethanone |
| SMILES | CC1SCCSC1C(=O)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C13H15ClOS2/c1-9-13(17-6-5-16-9)12(15)8-10-3-2-4-11(14)7-10/h2-4,7,9,13H,5-6,8H2,1H3 |
| InChIKey | HXTOJQAIAXNYTE-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.85 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |