C10H18O2S2 — CID 115385987
2-ethoxy-1-(3-ethyl-1,4-dithian-2-yl)ethanone (PubChem CID 115385987) has the molecular formula C10H18O2S2 and a molecular weight of 234.39 g/mol. Its IUPAC name is 2-ethoxy-1-(3-ethyl-1,4-dithian-2-yl)ethanone.
| Compound Name | 2-ethoxy-1-(3-ethyl-1,4-dithian-2-yl)ethanone |
|---|---|
| PubChem CID | 115385987 |
| Molecular Formula | C10H18O2S2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | 2-ethoxy-1-(3-ethyl-1,4-dithian-2-yl)ethanone |
| SMILES | CCOCC(=O)C1SCCSC1CC |
| InChI | InChI=1S/C10H18O2S2/c1-3-9-10(14-6-5-13-9)8(11)7-12-4-2/h9-10H,3-7H2,1-2H3 |
| InChIKey | NDAHUJULAXLJDO-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |