C15H26OS2 — CID 115385996
(2-ethylcyclohexyl)-(3-ethyl-1,4-dithian-2-yl)methanone (PubChem CID 115385996) has the molecular formula C15H26OS2 and a molecular weight of 286.51 g/mol. Its IUPAC name is (2-ethylcyclohexyl)-(3-ethyl-1,4-dithian-2-yl)methanone.
| Compound Name | (2-ethylcyclohexyl)-(3-ethyl-1,4-dithian-2-yl)methanone |
|---|---|
| PubChem CID | 115385996 |
| Molecular Formula | C15H26OS2 |
| Molecular Weight | 286.51 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | (2-ethylcyclohexyl)-(3-ethyl-1,4-dithian-2-yl)methanone |
| SMILES | CCC1CCCCC1C(=O)C1SCCSC1CC |
| InChI | InChI=1S/C15H26OS2/c1-3-11-7-5-6-8-12(11)14(16)15-13(4-2)17-9-10-18-15/h11-13,15H,3-10H2,1-2H3 |
| InChIKey | BHRSISDMYCNBSO-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.51 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |