C16H22N2OS2 — CID 115386324
1-(3-ethyl-1,4-dithian-2-yl)-2-(1-methylbenzimidazol-2-yl)ethanol (PubChem CID 115386324) has the molecular formula C16H22N2OS2 and a molecular weight of 322.50 g/mol. Its IUPAC name is 1-(3-ethyl-1,4-dithian-2-yl)-2-(1-methylbenzimidazol-2-yl)ethanol.
| Compound Name | 1-(3-ethyl-1,4-dithian-2-yl)-2-(1-methylbenzimidazol-2-yl)ethanol |
|---|---|
| PubChem CID | 115386324 |
| Molecular Formula | C16H22N2OS2 |
| Molecular Weight | 322.50 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | 1-(3-ethyl-1,4-dithian-2-yl)-2-(1-methylbenzimidazol-2-yl)ethanol |
| SMILES | CCC1SCCSC1C(O)Cc1nc2ccccc2n1C |
| InChI | InChI=1S/C16H22N2OS2/c1-3-14-16(21-9-8-20-14)13(19)10-15-17-11-6-4-5-7-12(11)18(15)2/h4-7,13-14,16,19H,3,8-10H2,1-2H3 |
| InChIKey | QRJCJQRVWRJTCF-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.50 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |