C15H23NS2 — CID 115386577
2-(4-ethylphenyl)-1-(3-methyl-1,4-dithian-2-yl)ethanamine (PubChem CID 115386577) has the molecular formula C15H23NS2 and a molecular weight of 281.49 g/mol. Its IUPAC name is 2-(4-ethylphenyl)-1-(3-methyl-1,4-dithian-2-yl)ethanamine.
| Compound Name | 2-(4-ethylphenyl)-1-(3-methyl-1,4-dithian-2-yl)ethanamine |
|---|---|
| PubChem CID | 115386577 |
| Molecular Formula | C15H23NS2 |
| Molecular Weight | 281.49 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | 2-(4-ethylphenyl)-1-(3-methyl-1,4-dithian-2-yl)ethanamine |
| SMILES | CCc1ccc(CC(N)C2SCCSC2C)cc1 |
| InChI | InChI=1S/C15H23NS2/c1-3-12-4-6-13(7-5-12)10-14(16)15-11(2)17-8-9-18-15/h4-7,11,14-15H,3,8-10,16H2,1-2H3 |
| InChIKey | COKPRTKRBCKRMD-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.49 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |