C12H25NS2 — CID 82922480
3-ethyl-1-(3-methyl-1,4-dithian-2-yl)pentan-1-amine (PubChem CID 82922480) has the molecular formula C12H25NS2 and a molecular weight of 247.47 g/mol. Its IUPAC name is 3-ethyl-1-(3-methyl-1,4-dithian-2-yl)pentan-1-amine.
| Compound Name | 3-ethyl-1-(3-methyl-1,4-dithian-2-yl)pentan-1-amine |
|---|---|
| PubChem CID | 82922480 |
| Molecular Formula | C12H25NS2 |
| Molecular Weight | 247.47 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | 3-ethyl-1-(3-methyl-1,4-dithian-2-yl)pentan-1-amine |
| SMILES | CCC(CC)CC(N)C1SCCSC1C |
| InChI | InChI=1S/C12H25NS2/c1-4-10(5-2)8-11(13)12-9(3)14-6-7-15-12/h9-12H,4-8,13H2,1-3H3 |
| InChIKey | KGBBZIXQIQYUHR-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.47 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |