C10H19NS2 — CID 115386776
N-methyl-1-(3-methyl-1,4-dithian-2-yl)but-3-en-1-amine (PubChem CID 115386776) has the molecular formula C10H19NS2 and a molecular weight of 217.40 g/mol. Its IUPAC name is N-methyl-1-(3-methyl-1,4-dithian-2-yl)but-3-en-1-amine.
| Compound Name | N-methyl-1-(3-methyl-1,4-dithian-2-yl)but-3-en-1-amine |
|---|---|
| PubChem CID | 115386776 |
| Molecular Formula | C10H19NS2 |
| Molecular Weight | 217.40 g/mol |
| Exact Mass | 217.10 |
| IUPAC Name | N-methyl-1-(3-methyl-1,4-dithian-2-yl)but-3-en-1-amine |
| SMILES | C=CCC(NC)C1SCCSC1C |
| InChI | InChI=1S/C10H19NS2/c1-4-5-9(11-3)10-8(2)12-6-7-13-10/h4,8-11H,1,5-7H2,2-3H3 |
| InChIKey | ZILGCCHADYGTBC-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.40 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|