C9H13ClF3N3 — CID 115397867
4-tert-butyl-3-(chloromethyl)-5-(2,2,2-trifluoroethyl)-1,2,4-triazole (PubChem CID 115397867) has the molecular formula C9H13ClF3N3 and a molecular weight of 255.67 g/mol. Its IUPAC name is 4-tert-butyl-3-(chloromethyl)-5-(2,2,2-trifluoroethyl)-1,2,4-triazole.
| Compound Name | 4-tert-butyl-3-(chloromethyl)-5-(2,2,2-trifluoroethyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 115397867 |
| Molecular Formula | C9H13ClF3N3 |
| Molecular Weight | 255.67 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | 4-tert-butyl-3-(chloromethyl)-5-(2,2,2-trifluoroethyl)-1,2,4-triazole |
| SMILES | CC(C)(C)n1c(CCl)nnc1CC(F)(F)F |
| InChI | InChI=1S/C9H13ClF3N3/c1-8(2,3)16-6(4-9(11,12)13)14-15-7(16)5-10/h4-5H2,1-3H3 |
| InChIKey | ZJWUQVYLAVQOJT-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.67 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|