C8H14BrN3O — CID 115399000
3-(bromomethyl)-5-ethoxy-4-propan-2-yl-1,2,4-triazole (PubChem CID 115399000) has the molecular formula C8H14BrN3O and a molecular weight of 248.12 g/mol. Its IUPAC name is 3-(bromomethyl)-5-ethoxy-4-propan-2-yl-1,2,4-triazole.
| Compound Name | 3-(bromomethyl)-5-ethoxy-4-propan-2-yl-1,2,4-triazole |
|---|---|
| PubChem CID | 115399000 |
| Molecular Formula | C8H14BrN3O |
| Molecular Weight | 248.12 g/mol |
| Exact Mass | 247.03 |
| IUPAC Name | 3-(bromomethyl)-5-ethoxy-4-propan-2-yl-1,2,4-triazole |
| SMILES | CCOc1nnc(CBr)n1C(C)C |
| InChI | InChI=1S/C8H14BrN3O/c1-4-13-8-11-10-7(5-9)12(8)6(2)3/h6H,4-5H2,1-3H3 |
| InChIKey | LNJAYGWBTCDOED-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.12 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|