C7H12BrN3O — CID 115399488
3-(bromomethyl)-5-ethoxy-4-ethyl-1,2,4-triazole (PubChem CID 115399488) has the molecular formula C7H12BrN3O and a molecular weight of 234.10 g/mol. Its IUPAC name is 3-(bromomethyl)-5-ethoxy-4-ethyl-1,2,4-triazole.
| Compound Name | 3-(bromomethyl)-5-ethoxy-4-ethyl-1,2,4-triazole |
|---|---|
| PubChem CID | 115399488 |
| Molecular Formula | C7H12BrN3O |
| Molecular Weight | 234.10 g/mol |
| Exact Mass | 233.02 |
| IUPAC Name | 3-(bromomethyl)-5-ethoxy-4-ethyl-1,2,4-triazole |
| SMILES | CCOc1nnc(CBr)n1CC |
| InChI | InChI=1S/C7H12BrN3O/c1-3-11-6(5-8)9-10-7(11)12-4-2/h3-5H2,1-2H3 |
| InChIKey | NQTVQUVKLKBXIS-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.10 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|