C13H12N2O — CID 115403766
2-(furan-2-yl)-3,6-dimethylimidazo[1,2-a]pyridine (PubChem CID 115403766) has the molecular formula C13H12N2O and a molecular weight of 212.25 g/mol. Its IUPAC name is 2-(furan-2-yl)-3,6-dimethylimidazo[1,2-a]pyridine.
| Compound Name | 2-(furan-2-yl)-3,6-dimethylimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 115403766 |
| Molecular Formula | C13H12N2O |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | 2-(furan-2-yl)-3,6-dimethylimidazo[1,2-a]pyridine |
| SMILES | Cc1ccc2nc(-c3ccco3)c(C)n2c1 |
| InChI | InChI=1S/C13H12N2O/c1-9-5-6-12-14-13(10(2)15(12)8-9)11-4-3-7-16-11/h3-8H,1-2H3 |
| InChIKey | AQVDONQOYZTCPT-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 30.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |