C12H15N3 — CID 115404390
5,10,12-trimethyl-1,7,9-triazatricyclo[6.4.0.02,6]dodeca-2(6),7,9,11-tetraene (PubChem CID 115404390) has the molecular formula C12H15N3 and a molecular weight of 201.27 g/mol. Its IUPAC name is 5,10,12-trimethyl-1,7,9-triazatricyclo[6.4.0.02,6]dodeca-2(6),7,9,11-tetraene.
| Compound Name | 5,10,12-trimethyl-1,7,9-triazatricyclo[6.4.0.02,6]dodeca-2(6),7,9,11-tetraene |
|---|---|
| PubChem CID | 115404390 |
| Molecular Formula | C12H15N3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | 5,10,12-trimethyl-1,7,9-triazatricyclo[6.4.0.02,6]dodeca-2(6),7,9,11-tetraene |
| SMILES | Cc1cc(C)n2c3c(nc2n1)C(C)CC3 |
| InChI | InChI=1S/C12H15N3/c1-7-4-5-10-11(7)14-12-13-8(2)6-9(3)15(10)12/h6-7H,4-5H2,1-3H3 |
| InChIKey | HIHFRHIMBYDZMK-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |