C11H14ClN — CID 12798309
4-chloro-2,8-dimethyl-5,6,7,8-tetrahydroquinoline (PubChem CID 12798309) has the molecular formula C11H14ClN and a molecular weight of 195.69 g/mol. Its IUPAC name is 4-chloro-2,8-dimethyl-5,6,7,8-tetrahydroquinoline.
| Compound Name | 4-chloro-2,8-dimethyl-5,6,7,8-tetrahydroquinoline |
|---|---|
| PubChem CID | 12798309 |
| Molecular Formula | C11H14ClN |
| Molecular Weight | 195.69 g/mol |
| Exact Mass | 195.08 |
| IUPAC Name | 4-chloro-2,8-dimethyl-5,6,7,8-tetrahydroquinoline |
| SMILES | Cc1cc(Cl)c2c(n1)C(C)CCC2 |
| InChI | InChI=1S/C11H14ClN/c1-7-4-3-5-9-10(12)6-8(2)13-11(7)9/h6-7H,3-5H2,1-2H3 |
| InChIKey | BPHPSPMYQQASIS-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.69 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |