C10H12ClN — CID 72743006
2-chloro-8-methyl-5,6,7,8-tetrahydroquinoline (PubChem CID 72743006) has the molecular formula C10H12ClN and a molecular weight of 181.67 g/mol. Its IUPAC name is 2-chloro-8-methyl-5,6,7,8-tetrahydroquinoline.
| Compound Name | 2-chloro-8-methyl-5,6,7,8-tetrahydroquinoline |
|---|---|
| PubChem CID | 72743006 |
| Molecular Formula | C10H12ClN |
| Molecular Weight | 181.67 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | 2-chloro-8-methyl-5,6,7,8-tetrahydroquinoline |
| SMILES | CC1CCCc2ccc(Cl)nc21 |
| InChI | InChI=1S/C10H12ClN/c1-7-3-2-4-8-5-6-9(11)12-10(7)8/h5-7H,2-4H2,1H3 |
| InChIKey | JITQGIDSIWOHJG-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.67 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|