C9H11ClN2 — CID 21036673
2-chloro-5-methyl-5,6,7,8-tetrahydroquinoxaline (PubChem CID 21036673) has the molecular formula C9H11ClN2 and a molecular weight of 182.65 g/mol. Its IUPAC name is 2-chloro-5-methyl-5,6,7,8-tetrahydroquinoxaline.
| Compound Name | 2-chloro-5-methyl-5,6,7,8-tetrahydroquinoxaline |
|---|---|
| PubChem CID | 21036673 |
| Molecular Formula | C9H11ClN2 |
| Molecular Weight | 182.65 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | 2-chloro-5-methyl-5,6,7,8-tetrahydroquinoxaline |
| SMILES | CC1CCCc2nc(Cl)cnc21 |
| InChI | InChI=1S/C9H11ClN2/c1-6-3-2-4-7-9(6)11-5-8(10)12-7/h5-6H,2-4H2,1H3 |
| InChIKey | JQWFMVPENLRTSW-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.65 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |