C9H11ClN2 — CID 129079478
2-chloro-5,6,7,8-tetrahydroquinolin-5-amine (PubChem CID 129079478) has the molecular formula C9H11ClN2 and a molecular weight of 182.65 g/mol. Its IUPAC name is 2-chloro-5,6,7,8-tetrahydroquinolin-5-amine.
| Compound Name | 2-chloro-5,6,7,8-tetrahydroquinolin-5-amine |
|---|---|
| PubChem CID | 129079478 |
| Molecular Formula | C9H11ClN2 |
| Molecular Weight | 182.65 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | 2-chloro-5,6,7,8-tetrahydroquinolin-5-amine |
| SMILES | NC1CCCc2nc(Cl)ccc21 |
| InChI | InChI=1S/C9H11ClN2/c10-9-5-4-6-7(11)2-1-3-8(6)12-9/h4-5,7H,1-3,11H2 |
| InChIKey | OOINNTVVHDJXLD-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.65 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|