C13H20N2O — CID 70962707
(5R)-2-butoxy-5,6,7,8-tetrahydroquinolin-5-amine (PubChem CID 70962707) has the molecular formula C13H20N2O and a molecular weight of 220.32 g/mol. Its IUPAC name is (5R)-2-butoxy-5,6,7,8-tetrahydroquinolin-5-amine.
| Compound Name | (5R)-2-butoxy-5,6,7,8-tetrahydroquinolin-5-amine |
|---|---|
| PubChem CID | 70962707 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | (5R)-2-butoxy-5,6,7,8-tetrahydroquinolin-5-amine |
| SMILES | CCCCOc1ccc2c(n1)CCC[C@H]2N |
| InChI | InChI=1S/C13H20N2O/c1-2-3-9-16-13-8-7-10-11(14)5-4-6-12(10)15-13/h7-8,11H,2-6,9,14H2,1H3/t11-/m1/s1 |
| InChIKey | DQIXKBMWMRYWGX-LLVKDONJSA-N |
| XLogP | 2.60 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|