C13H20N2 — CID 143063262
3,5-dimethyl-2-propyl-5,6,7,8-tetrahydroquinoxaline (PubChem CID 143063262) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is 3,5-dimethyl-2-propyl-5,6,7,8-tetrahydroquinoxaline.
| Compound Name | 3,5-dimethyl-2-propyl-5,6,7,8-tetrahydroquinoxaline |
|---|---|
| PubChem CID | 143063262 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | 3,5-dimethyl-2-propyl-5,6,7,8-tetrahydroquinoxaline |
| SMILES | CCCc1nc2c(nc1C)C(C)CCC2 |
| InChI | InChI=1S/C13H20N2/c1-4-6-11-10(3)14-13-9(2)7-5-8-12(13)15-11/h9H,4-8H2,1-3H3 |
| InChIKey | VNNDUNLEOXULTK-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |