C21H27BrCl4N4 — CID 158029898
5-bromo-2,3-dimethyl-5,6,7,8-tetrahydroquinoxaline;2,3-dimethyl-5,6,7,8-tetrahydroquinoxaline;tetrachloromethane (PubChem CID 158029898) has the molecular formula C21H27BrCl4N4 and a molecular weight of 557.19 g/mol. Its IUPAC name is 5-bromo-2,3-dimethyl-5,6,7,8-tetrahydroquinoxaline;2,3-dimethyl-5,6,7,8-tetrahydroquinoxaline;tetrachloromethane.
| Compound Name | 5-bromo-2,3-dimethyl-5,6,7,8-tetrahydroquinoxaline;2,3-dimethyl-5,6,7,8-tetrahydroquinoxaline;tetrachloromethane |
|---|---|
| PubChem CID | 158029898 |
| Molecular Formula | C21H27BrCl4N4 |
| Molecular Weight | 557.19 g/mol |
| Exact Mass | 554.02 |
| IUPAC Name | 5-bromo-2,3-dimethyl-5,6,7,8-tetrahydroquinoxaline;2,3-dimethyl-5,6,7,8-tetrahydroquinoxaline;tetrachloromethane |
| SMILES | Cc1nc2c(nc1C)C(Br)CCC2.Cc1nc2c(nc1C)CCCC2.ClC(Cl)(Cl)Cl |
| InChI | InChI=1S/C10H13BrN2.C10H14N2.CCl4/c1-6-7(2)13-10-8(11)4-3-5-9(10)12-6;1-7-8(2)12-10-6-4-3-5-9(10)11-7;2-1(3,4)5/h8H,3-5H2,1-2H3;3-6H2,1-2H3; |
| InChIKey | FHBATLUOQNFEHN-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.19 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|