C12H14BrF — CID 130892688
1-bromo-5-fluoro-7,8-dimethyl-1,2,3,4-tetrahydronaphthalene (PubChem CID 130892688) has the molecular formula C12H14BrF and a molecular weight of 257.15 g/mol. Its IUPAC name is 1-bromo-5-fluoro-7,8-dimethyl-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 1-bromo-5-fluoro-7,8-dimethyl-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 130892688 |
| Molecular Formula | C12H14BrF |
| Molecular Weight | 257.15 g/mol |
| Exact Mass | 256.03 |
| IUPAC Name | 1-bromo-5-fluoro-7,8-dimethyl-1,2,3,4-tetrahydronaphthalene |
| SMILES | Cc1cc(F)c2c(c1C)C(Br)CCC2 |
| InChI | InChI=1S/C12H14BrF/c1-7-6-11(14)9-4-3-5-10(13)12(9)8(7)2/h6,10H,3-5H2,1-2H3 |
| InChIKey | NNTVGDJEKRPDKU-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.15 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|