About 2,8-diazatricyclo[7.3.0.03,7]dodeca-1,3(7),8-triene
2,8-diazatricyclo[7.3.0.03,7]dodeca-1,3(7),8-triene (PubChem CID 15156626) has the molecular formula C10H12N2
and a molecular weight of 160.22 g/mol. Its IUPAC name is 2,8-diazatricyclo[7.3.0.03,7]dodeca-1,3(7),8-triene.
Analyze 2,8-diazatricyclo[7.3.0.03,7]dodeca-1,3(7),8-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,8-diazatricyclo[7.3.0.03,7]dodeca-1,3(7),8-triene?
The IUPAC name of 2,8-diazatricyclo[7.3.0.03,7]dodeca-1,3(7),8-triene (CID 15156626) is 2,8-diazatricyclo[7.3.0.03,7]dodeca-1,3(7),8-triene.
What is the SMILES notation for 2,8-diazatricyclo[7.3.0.03,7]dodeca-1,3(7),8-triene?
The canonical SMILES for 2,8-diazatricyclo[7.3.0.03,7]dodeca-1,3(7),8-triene is C1Cc2nc3c(nc2C1)CCC3.
What is the InChIKey of 2,8-diazatricyclo[7.3.0.03,7]dodeca-1,3(7),8-triene?
The InChIKey is ISGZKEZFGDEYSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2/c1-3-7-8(4-1)12-10-6-2-5-9(10)11-7/h1-6H2.
What are the key properties of 2,8-diazatricyclo[7.3.0.03,7]dodeca-1,3(7),8-triene?
2,8-diazatricyclo[7.3.0.03,7]dodeca-1,3(7),8-triene has a molecular weight of 160.22 g/mol, XLogP of 1.45, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,8-diazatricyclo[7.3.0.03,7]dodeca-1,3(7),8-triene is sourced from PubChem (CID 15156626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).