C12H12N2O — CID 115405090
2-cyclopropyl-8-methylimidazo[1,2-a]pyridine-3-carbaldehyde (PubChem CID 115405090) has the molecular formula C12H12N2O and a molecular weight of 200.24 g/mol. Its IUPAC name is 2-cyclopropyl-8-methylimidazo[1,2-a]pyridine-3-carbaldehyde.
| Compound Name | 2-cyclopropyl-8-methylimidazo[1,2-a]pyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 115405090 |
| Molecular Formula | C12H12N2O |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.09 |
| IUPAC Name | 2-cyclopropyl-8-methylimidazo[1,2-a]pyridine-3-carbaldehyde |
| SMILES | Cc1cccn2c(C=O)c(C3CC3)nc12 |
| InChI | InChI=1S/C12H12N2O/c1-8-3-2-6-14-10(7-15)11(9-4-5-9)13-12(8)14/h2-3,6-7,9H,4-5H2,1H3 |
| InChIKey | YKXUAAZWLGXAHW-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|