C17H16N2O — CID 82529082
8-methyl-2-[(4-methylphenyl)methyl]imidazo[1,2-a]pyridine-3-carbaldehyde (PubChem CID 82529082) has the molecular formula C17H16N2O and a molecular weight of 264.33 g/mol. Its IUPAC name is 8-methyl-2-[(4-methylphenyl)methyl]imidazo[1,2-a]pyridine-3-carbaldehyde.
| Compound Name | 8-methyl-2-[(4-methylphenyl)methyl]imidazo[1,2-a]pyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 82529082 |
| Molecular Formula | C17H16N2O |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 8-methyl-2-[(4-methylphenyl)methyl]imidazo[1,2-a]pyridine-3-carbaldehyde |
| SMILES | Cc1ccc(Cc2nc3c(C)cccn3c2C=O)cc1 |
| InChI | InChI=1S/C17H16N2O/c1-12-5-7-14(8-6-12)10-15-16(11-20)19-9-3-4-13(2)17(19)18-15/h3-9,11H,10H2,1-2H3 |
| InChIKey | ONFYTUSOXXPYOK-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|