C20H22BrN3O5S — CID 11540529
N-[(4-bromophenyl)methyl]-4-ethyl-2-[2-(hydroxyamino)-2-oxoethyl]-1,1-dioxo-2,3-dihydro-1λ6,4-benzothiazine-6-carboxamide (PubChem CID 11540529) has the molecular formula C20H22BrN3O5S and a molecular weight of 496.38 g/mol. Its IUPAC name is N-[(4-bromophenyl)methyl]-4-ethyl-2-[2-(hydroxyamino)-2-oxoethyl]-1,1-dioxo-2,3-dihydro-1λ6,4-benzothiazine-6-carboxamide.
| Compound Name | N-[(4-bromophenyl)methyl]-4-ethyl-2-[2-(hydroxyamino)-2-oxoethyl]-1,1-dioxo-2,3-dihydro-1λ6,4-benzothiazine-6-carboxamide |
|---|---|
| PubChem CID | 11540529 |
| Molecular Formula | C20H22BrN3O5S |
| Molecular Weight | 496.38 g/mol |
| Exact Mass | 495.05 |
| IUPAC Name | N-[(4-bromophenyl)methyl]-4-ethyl-2-[2-(hydroxyamino)-2-oxoethyl]-1,1-dioxo-2,3-dihydro-1λ6,4-benzothiazine-6-carboxamide |
| SMILES | CCN1CC(CC(=O)NO)S(=O)(=O)c2ccc(C(=O)NCc3ccc(Br)cc3)cc21 |
| InChI | InChI=1S/C20H22BrN3O5S/c1-2-24-12-16(10-19(25)23-27)30(28,29)18-8-5-14(9-17(18)24)20(26)22-11-13-3-6-15(21)7-4-13/h3-9,16,27H,2,10-12H2,1H3,(H,22,26)(H,23,25) |
| InChIKey | HPYMOIBPOOGKDR-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.38 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|