C20H22N4O7S — CID 11561714
4-ethyl-2-[2-(hydroxyamino)-2-oxoethyl]-N-[(4-nitrophenyl)methyl]-1,1-dioxo-2,3-dihydro-1λ6,4-benzothiazine-6-carboxamide (PubChem CID 11561714) has the molecular formula C20H22N4O7S and a molecular weight of 462.48 g/mol. Its IUPAC name is 4-ethyl-2-[2-(hydroxyamino)-2-oxoethyl]-N-[(4-nitrophenyl)methyl]-1,1-dioxo-2,3-dihydro-1λ6,4-benzothiazine-6-carboxamide.
| Compound Name | 4-ethyl-2-[2-(hydroxyamino)-2-oxoethyl]-N-[(4-nitrophenyl)methyl]-1,1-dioxo-2,3-dihydro-1λ6,4-benzothiazine-6-carboxamide |
|---|---|
| PubChem CID | 11561714 |
| Molecular Formula | C20H22N4O7S |
| Molecular Weight | 462.48 g/mol |
| Exact Mass | 462.12 |
| IUPAC Name | 4-ethyl-2-[2-(hydroxyamino)-2-oxoethyl]-N-[(4-nitrophenyl)methyl]-1,1-dioxo-2,3-dihydro-1λ6,4-benzothiazine-6-carboxamide |
| SMILES | CCN1CC(CC(=O)NO)S(=O)(=O)c2ccc(C(=O)NCc3ccc([N+](=O)[O-])cc3)cc21 |
| InChI | InChI=1S/C20H22N4O7S/c1-2-23-12-16(10-19(25)22-27)32(30,31)18-8-5-14(9-17(18)23)20(26)21-11-13-3-6-15(7-4-13)24(28)29/h3-9,16,27H,2,10-12H2,1H3,(H,21,26)(H,22,25) |
| InChIKey | VAOZWEWQKRNVIB-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 158.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.48 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|