C21H25N3O6S — CID 87624462
4-ethyl-2-N-hydroxy-6-N-[(4-methoxyphenyl)methyl]-3-methyl-1,1-dioxo-2,3-dihydro-1λ6,4-benzothiazine-2,6-dicarboxamide (PubChem CID 87624462) has the molecular formula C21H25N3O6S and a molecular weight of 447.51 g/mol. Its IUPAC name is 4-ethyl-2-N-hydroxy-6-N-[(4-methoxyphenyl)methyl]-3-methyl-1,1-dioxo-2,3-dihydro-1λ6,4-benzothiazine-2,6-dicarboxamide.
| Compound Name | 4-ethyl-2-N-hydroxy-6-N-[(4-methoxyphenyl)methyl]-3-methyl-1,1-dioxo-2,3-dihydro-1λ6,4-benzothiazine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 87624462 |
| Molecular Formula | C21H25N3O6S |
| Molecular Weight | 447.51 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | 4-ethyl-2-N-hydroxy-6-N-[(4-methoxyphenyl)methyl]-3-methyl-1,1-dioxo-2,3-dihydro-1λ6,4-benzothiazine-2,6-dicarboxamide |
| SMILES | CCN1c2cc(C(=O)NCc3ccc(OC)cc3)ccc2S(=O)(=O)C(C(=O)NO)C1C |
| InChI | InChI=1S/C21H25N3O6S/c1-4-24-13(2)19(21(26)23-27)31(28,29)18-10-7-15(11-17(18)24)20(25)22-12-14-5-8-16(30-3)9-6-14/h5-11,13,19,27H,4,12H2,1-3H3,(H,22,25)(H,23,26) |
| InChIKey | RCBVVMHEBDYTMN-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.51 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|