C8H16F2N2 — CID 115406076
N-(2,2-difluoroethyl)-1,5-dimethylpyrrolidin-3-amine (PubChem CID 115406076) has the molecular formula C8H16F2N2 and a molecular weight of 178.23 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-1,5-dimethylpyrrolidin-3-amine.
| Compound Name | N-(2,2-difluoroethyl)-1,5-dimethylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 115406076 |
| Molecular Formula | C8H16F2N2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.13 |
| IUPAC Name | N-(2,2-difluoroethyl)-1,5-dimethylpyrrolidin-3-amine |
| SMILES | CC1CC(NCC(F)F)CN1C |
| InChI | InChI=1S/C8H16F2N2/c1-6-3-7(5-12(6)2)11-4-8(9)10/h6-8,11H,3-5H2,1-2H3 |
| InChIKey | SAGMZWWJFNXZRA-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |