C13H12BrF2N — CID 115406977
N-[(6-bromonaphthalen-2-yl)methyl]-2,2-difluoroethanamine (PubChem CID 115406977) has the molecular formula C13H12BrF2N and a molecular weight of 300.15 g/mol. Its IUPAC name is N-[(6-bromonaphthalen-2-yl)methyl]-2,2-difluoroethanamine.
| Compound Name | N-[(6-bromonaphthalen-2-yl)methyl]-2,2-difluoroethanamine |
|---|---|
| PubChem CID | 115406977 |
| Molecular Formula | C13H12BrF2N |
| Molecular Weight | 300.15 g/mol |
| Exact Mass | 299.01 |
| IUPAC Name | N-[(6-bromonaphthalen-2-yl)methyl]-2,2-difluoroethanamine |
| SMILES | FC(F)CNCc1ccc2cc(Br)ccc2c1 |
| InChI | InChI=1S/C13H12BrF2N/c14-12-4-3-10-5-9(1-2-11(10)6-12)7-17-8-13(15)16/h1-6,13,17H,7-8H2 |
| InChIKey | NGAHGOAVGURPIJ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.15 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |