C11H15F2NO2 — CID 115407135
N-[(2,6-dimethoxyphenyl)methyl]-2,2-difluoroethanamine (PubChem CID 115407135) has the molecular formula C11H15F2NO2 and a molecular weight of 231.24 g/mol. Its IUPAC name is N-[(2,6-dimethoxyphenyl)methyl]-2,2-difluoroethanamine.
| Compound Name | N-[(2,6-dimethoxyphenyl)methyl]-2,2-difluoroethanamine |
|---|---|
| PubChem CID | 115407135 |
| Molecular Formula | C11H15F2NO2 |
| Molecular Weight | 231.24 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | N-[(2,6-dimethoxyphenyl)methyl]-2,2-difluoroethanamine |
| SMILES | COc1cccc(OC)c1CNCC(F)F |
| InChI | InChI=1S/C11H15F2NO2/c1-15-9-4-3-5-10(16-2)8(9)6-14-7-11(12)13/h3-5,11,14H,6-7H2,1-2H3 |
| InChIKey | MCFAVMKLYMSNSJ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.24 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |