C29H41N3O3S — CID 11540783
7-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propoxymethyl]-2-[(4-methylsulfonylphenyl)methyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine (PubChem CID 11540783) has the molecular formula C29H41N3O3S and a molecular weight of 511.73 g/mol. Its IUPAC name is 7-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propoxymethyl]-2-[(4-methylsulfonylphenyl)methyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine.
| Compound Name | 7-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propoxymethyl]-2-[(4-methylsulfonylphenyl)methyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine |
|---|---|
| PubChem CID | 11540783 |
| Molecular Formula | C29H41N3O3S |
| Molecular Weight | 511.73 g/mol |
| Exact Mass | 511.29 |
| IUPAC Name | 7-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propoxymethyl]-2-[(4-methylsulfonylphenyl)methyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine |
| SMILES | CS(=O)(=O)c1ccc(CN2CCN3CC(COCCCN4CCc5ccccc5C4)CCC3C2)cc1 |
| InChI | InChI=1S/C29H41N3O3S/c1-36(33,34)29-11-8-24(9-12-29)19-31-16-17-32-20-25(7-10-28(32)22-31)23-35-18-4-14-30-15-13-26-5-2-3-6-27(26)21-30/h2-3,5-6,8-9,11-12,25,28H,4,7,10,13-23H2,1H3 |
| InChIKey | KBQSUHWEPWBSEA-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.73 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|