C23H37N3O3S — CID 90742559
7-[azetidin-1-yl(propoxy)methyl]-2-[(4-methylsulfonylphenyl)methyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine (PubChem CID 90742559) has the molecular formula C23H37N3O3S and a molecular weight of 435.63 g/mol. Its IUPAC name is 7-[azetidin-1-yl(propoxy)methyl]-2-[(4-methylsulfonylphenyl)methyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine.
| Compound Name | 7-[azetidin-1-yl(propoxy)methyl]-2-[(4-methylsulfonylphenyl)methyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine |
|---|---|
| PubChem CID | 90742559 |
| Molecular Formula | C23H37N3O3S |
| Molecular Weight | 435.63 g/mol |
| Exact Mass | 435.26 |
| IUPAC Name | 7-[azetidin-1-yl(propoxy)methyl]-2-[(4-methylsulfonylphenyl)methyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine |
| SMILES | CCCOC(C1CCC2CN(Cc3ccc(S(C)(=O)=O)cc3)CCN2C1)N1CCC1 |
| InChI | InChI=1S/C23H37N3O3S/c1-3-15-29-23(25-11-4-12-25)20-7-8-21-18-24(13-14-26(21)17-20)16-19-5-9-22(10-6-19)30(2,27)28/h5-6,9-10,20-21,23H,3-4,7-8,11-18H2,1-2H3 |
| InChIKey | IGKMEDFUNRRUHY-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.63 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |