C27H45N3O3S — CID 11591276
7-[3-(2,6-dimethylpiperidin-1-yl)propoxymethyl]-2-[(4-methylsulfonylphenyl)methyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine (PubChem CID 11591276) has the molecular formula C27H45N3O3S and a molecular weight of 491.74 g/mol. Its IUPAC name is 7-[3-(2,6-dimethylpiperidin-1-yl)propoxymethyl]-2-[(4-methylsulfonylphenyl)methyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine.
| Compound Name | 7-[3-(2,6-dimethylpiperidin-1-yl)propoxymethyl]-2-[(4-methylsulfonylphenyl)methyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine |
|---|---|
| PubChem CID | 11591276 |
| Molecular Formula | C27H45N3O3S |
| Molecular Weight | 491.74 g/mol |
| Exact Mass | 491.32 |
| IUPAC Name | 7-[3-(2,6-dimethylpiperidin-1-yl)propoxymethyl]-2-[(4-methylsulfonylphenyl)methyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine |
| SMILES | CC1CCCC(C)N1CCCOCC1CCC2CN(Cc3ccc(S(C)(=O)=O)cc3)CCN2C1 |
| InChI | InChI=1S/C27H45N3O3S/c1-22-6-4-7-23(2)30(22)14-5-17-33-21-25-8-11-26-20-28(15-16-29(26)19-25)18-24-9-12-27(13-10-24)34(3,31)32/h9-10,12-13,22-23,25-26H,4-8,11,14-21H2,1-3H3 |
| InChIKey | OKQHOSDIIFXBJO-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.74 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|