C24H38FN3O — CID 69465221
(9aS)-2-[(4-fluorophenyl)methyl]-7-(3-piperidin-1-ylpropoxymethyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine (PubChem CID 69465221) has the molecular formula C24H38FN3O and a molecular weight of 403.59 g/mol. Its IUPAC name is (9aS)-2-[(4-fluorophenyl)methyl]-7-(3-piperidin-1-ylpropoxymethyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine.
| Compound Name | (9aS)-2-[(4-fluorophenyl)methyl]-7-(3-piperidin-1-ylpropoxymethyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine |
|---|---|
| PubChem CID | 69465221 |
| Molecular Formula | C24H38FN3O |
| Molecular Weight | 403.59 g/mol |
| Exact Mass | 403.30 |
| IUPAC Name | (9aS)-2-[(4-fluorophenyl)methyl]-7-(3-piperidin-1-ylpropoxymethyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine |
| SMILES | Fc1ccc(CN2CCN3CC(COCCCN4CCCCC4)CC[C@H]3C2)cc1 |
| InChI | InChI=1S/C24H38FN3O/c25-23-8-5-21(6-9-23)17-27-14-15-28-18-22(7-10-24(28)19-27)20-29-16-4-13-26-11-2-1-3-12-26/h5-6,8-9,22,24H,1-4,7,10-20H2/t22?,24-/m0/s1 |
| InChIKey | AENULKNWCCEQIU-GITCGBDTSA-N |
| XLogP | 3.61 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.59 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|