C21H31ClN2O — CID 11631928
(1S,5R)-3-[(4-chlorophenyl)methyl]-6-(3-piperidin-1-ylpropoxymethyl)-3-azabicyclo[3.1.0]hexane (PubChem CID 11631928) has the molecular formula C21H31ClN2O and a molecular weight of 362.95 g/mol. Its IUPAC name is (1S,5R)-3-[(4-chlorophenyl)methyl]-6-(3-piperidin-1-ylpropoxymethyl)-3-azabicyclo[3.1.0]hexane.
| Compound Name | (1S,5R)-3-[(4-chlorophenyl)methyl]-6-(3-piperidin-1-ylpropoxymethyl)-3-azabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 11631928 |
| Molecular Formula | C21H31ClN2O |
| Molecular Weight | 362.95 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | (1S,5R)-3-[(4-chlorophenyl)methyl]-6-(3-piperidin-1-ylpropoxymethyl)-3-azabicyclo[3.1.0]hexane |
| SMILES | Clc1ccc(CN2C[C@@H]3C(COCCCN4CCCCC4)[C@@H]3C2)cc1 |
| InChI | InChI=1S/C21H31ClN2O/c22-18-7-5-17(6-8-18)13-24-14-19-20(15-24)21(19)16-25-12-4-11-23-9-2-1-3-10-23/h5-8,19-21H,1-4,9-16H2/t19-,20+,21? |
| InChIKey | MGYKSWIEJFWFBJ-WCRBZPEASA-N |
| XLogP | 3.91 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.95 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|