C22H32N2O3 — CID 73009584
3-(1,3-benzodioxol-4-ylmethyl)-6-(3-piperidin-1-ylpropoxymethyl)-3-azabicyclo[3.1.0]hexane (PubChem CID 73009584) has the molecular formula C22H32N2O3 and a molecular weight of 372.51 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-4-ylmethyl)-6-(3-piperidin-1-ylpropoxymethyl)-3-azabicyclo[3.1.0]hexane.
| Compound Name | 3-(1,3-benzodioxol-4-ylmethyl)-6-(3-piperidin-1-ylpropoxymethyl)-3-azabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 73009584 |
| Molecular Formula | C22H32N2O3 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.24 |
| IUPAC Name | 3-(1,3-benzodioxol-4-ylmethyl)-6-(3-piperidin-1-ylpropoxymethyl)-3-azabicyclo[3.1.0]hexane |
| SMILES | c1cc(CN2CC3C(COCCCN4CCCCC4)C3C2)c2c(c1)OCO2 |
| InChI | InChI=1S/C22H32N2O3/c1-2-8-23(9-3-1)10-5-11-25-15-20-18-13-24(14-19(18)20)12-17-6-4-7-21-22(17)27-16-26-21/h4,6-7,18-20H,1-3,5,8-16H2 |
| InChIKey | IIUKFUQBNDZULV-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|