C21H32N2O3 — CID 11530588
5-[[(1S,5R)-6-(3-piperidin-1-ylpropoxymethyl)-3-azabicyclo[3.1.0]hexan-3-yl]methyl]benzene-1,3-diol (PubChem CID 11530588) has the molecular formula C21H32N2O3 and a molecular weight of 360.50 g/mol. Its IUPAC name is 5-[[(1S,5R)-6-(3-piperidin-1-ylpropoxymethyl)-3-azabicyclo[3.1.0]hexan-3-yl]methyl]benzene-1,3-diol.
| Compound Name | 5-[[(1S,5R)-6-(3-piperidin-1-ylpropoxymethyl)-3-azabicyclo[3.1.0]hexan-3-yl]methyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 11530588 |
| Molecular Formula | C21H32N2O3 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.24 |
| IUPAC Name | 5-[[(1S,5R)-6-(3-piperidin-1-ylpropoxymethyl)-3-azabicyclo[3.1.0]hexan-3-yl]methyl]benzene-1,3-diol |
| SMILES | Oc1cc(O)cc(CN2C[C@@H]3C(COCCCN4CCCCC4)[C@@H]3C2)c1 |
| InChI | InChI=1S/C21H32N2O3/c24-17-9-16(10-18(25)11-17)12-23-13-19-20(14-23)21(19)15-26-8-4-7-22-5-2-1-3-6-22/h9-11,19-21,24-25H,1-8,12-15H2/t19-,20+,21? |
| InChIKey | YFRHHYDHHXOOGQ-WCRBZPEASA-N |
| XLogP | 2.67 |
| TPSA | 56.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|