About methyl 2-(2,2-difluoroethylamino)-1,3-thiazole-5-carboxylate
methyl 2-(2,2-difluoroethylamino)-1,3-thiazole-5-carboxylate (PubChem CID 115409396) has the molecular formula C7H8F2N2O2S
and a molecular weight of 222.22 g/mol. Its IUPAC name is methyl 2-(2,2-difluoroethylamino)-1,3-thiazole-5-carboxylate.
Analyze methyl 2-(2,2-difluoroethylamino)-1,3-thiazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(2,2-difluoroethylamino)-1,3-thiazole-5-carboxylate?
The IUPAC name of methyl 2-(2,2-difluoroethylamino)-1,3-thiazole-5-carboxylate (CID 115409396) is methyl 2-(2,2-difluoroethylamino)-1,3-thiazole-5-carboxylate.
What is the SMILES notation for methyl 2-(2,2-difluoroethylamino)-1,3-thiazole-5-carboxylate?
The canonical SMILES for methyl 2-(2,2-difluoroethylamino)-1,3-thiazole-5-carboxylate is COC(=O)c1cnc(NCC(F)F)s1.
What is the InChIKey of methyl 2-(2,2-difluoroethylamino)-1,3-thiazole-5-carboxylate?
The InChIKey is HKCCKAYQJIRYKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8F2N2O2S/c1-13-6(12)4-2-10-7(14-4)11-3-5(8)9/h2,5H,3H2,1H3,(H,10,11).
What are the key properties of methyl 2-(2,2-difluoroethylamino)-1,3-thiazole-5-carboxylate?
methyl 2-(2,2-difluoroethylamino)-1,3-thiazole-5-carboxylate has a molecular weight of 222.22 g/mol, XLogP of 1.61, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(2,2-difluoroethylamino)-1,3-thiazole-5-carboxylate is sourced from PubChem (CID 115409396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).